C10H9F6NO4S — CID 15947005
bis(2,2,2-trifluoroethyl) 2-(1,3-thiazolidin-2-ylidene)propanedioate (PubChem CID 15947005) has the molecular formula C10H9F6NO4S and a molecular weight of 353.24 g/mol. Its IUPAC name is bis(2,2,2-trifluoroethyl) 2-(1,3-thiazolidin-2-ylidene)propanedioate.
| Compound Name | bis(2,2,2-trifluoroethyl) 2-(1,3-thiazolidin-2-ylidene)propanedioate |
|---|---|
| PubChem CID | 15947005 |
| Molecular Formula | C10H9F6NO4S |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | bis(2,2,2-trifluoroethyl) 2-(1,3-thiazolidin-2-ylidene)propanedioate |
| SMILES | O=C(OCC(F)(F)F)C(C(=O)OCC(F)(F)F)=C1NCCS1 |
| InChI | InChI=1S/C10H9F6NO4S/c11-9(12,13)3-20-7(18)5(6-17-1-2-22-6)8(19)21-4-10(14,15)16/h17H,1-4H2 |
| InChIKey | IHLPLRJPAJWQOE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|