C7H10F8N2 — CID 159470670
N,N-bis(trifluoromethyl)ethenamine;1-fluoro-N-(fluoromethyl)-N-methylmethanamine (PubChem CID 159470670) has the molecular formula C7H10F8N2 and a molecular weight of 274.16 g/mol. Its IUPAC name is N,N-bis(trifluoromethyl)ethenamine;1-fluoro-N-(fluoromethyl)-N-methylmethanamine.
| Compound Name | N,N-bis(trifluoromethyl)ethenamine;1-fluoro-N-(fluoromethyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 159470670 |
| Molecular Formula | C7H10F8N2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N,N-bis(trifluoromethyl)ethenamine;1-fluoro-N-(fluoromethyl)-N-methylmethanamine |
| SMILES | C=CN(C(F)(F)F)C(F)(F)F.CN(CF)CF |
| InChI | InChI=1S/C4H3F6N.C3H7F2N/c1-2-11(3(5,6)7)4(8,9)10;1-6(2-4)3-5/h2H,1H2;2-3H2,1H3 |
| InChIKey | LVTJIYRVXPAWAC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|