About 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine
2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine (PubChem CID 159472819) has the molecular formula C17H35N
and a molecular weight of 253.47 g/mol. Its IUPAC name is 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine.
Molecular Properties
| Compound Name | 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine |
| PubChem CID | 159472819 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine |
| SMILES | C=C(C)CC(C)CC(CC)CN(CCC)CCC |
| InChI | InChI=1S/C17H35N/c1-7-10-18(11-8-2)14-17(9-3)13-16(6)12-15(4)5/h16-17H,4,7-14H2,1-3,5-6H3 |
| InChIKey | MXKQNVXGKITCTO-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine?
The IUPAC name of 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine (CID 159472819) is 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine.
What is the SMILES notation for 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine?
The canonical SMILES for 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine is C=C(C)CC(C)CC(CC)CN(CCC)CCC.
What is the InChIKey of 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine?
The InChIKey is MXKQNVXGKITCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35N/c1-7-10-18(11-8-2)14-17(9-3)13-16(6)12-15(4)5/h16-17H,4,7-14H2,1-3,5-6H3.
What are the key properties of 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine?
2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine has a molecular weight of 253.47 g/mol, XLogP of 5.13, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,6-dimethyl-N,N-dipropylhept-6-en-1-amine is sourced from PubChem (CID 159472819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).