C43H30BN3O2 — CID 159472866
1-[18-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]isoquinoline (PubChem CID 159472866) has the molecular formula C43H30BN3O2 and a molecular weight of 631.54 g/mol. Its IUPAC name is 1-[18-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]isoquinoline.
| Compound Name | 1-[18-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]isoquinoline |
|---|---|
| PubChem CID | 159472866 |
| Molecular Formula | C43H30BN3O2 |
| Molecular Weight | 631.54 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 1-[18-[1-(2,4,6-trimethylphenyl)benzimidazol-2-yl]-8,14-dioxa-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9(21),10,12,15(20),16,18-nonaen-4-yl]isoquinoline |
| SMILES | Cc1cc(C)c(-n2c(-c3ccc4c(c3)B3c5cc(-c6nccc7ccccc67)ccc5Oc5cccc(c53)O4)nc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C43H30BN3O2/c1-25-21-26(2)42(27(3)22-25)47-35-12-7-6-11-34(35)46-43(47)30-16-18-37-33(24-30)44-32-23-29(41-31-10-5-4-9-28(31)19-20-45-41)15-17-36(32)48-38-13-8-14-39(49-37)40(38)44/h4-24H,1-3H3 |
| InChIKey | YIDVJYJKZYBZMU-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.54 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|