About dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate
dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate (PubChem CID 159473798) has the molecular formula C9H19NO5S
and a molecular weight of 253.32 g/mol. Its IUPAC name is dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate.
Molecular Properties
| Compound Name | dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate |
| PubChem CID | 159473798 |
| Molecular Formula | C9H19NO5S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)[O-].C[NH+](C)CCCS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO3S.C4H6O2/c1-6(2)4-3-5-10(7,8)9;1-3(2)4(5)6/h3-5H2,1-2H3,(H,7,8,9);1H2,2H3,(H,5,6) |
| InChIKey | LWCYHXZGIKLQPO-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate?
The IUPAC name of dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate (CID 159473798) is dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate.
What is the SMILES notation for dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate?
The canonical SMILES for dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate is C=C(C)C(=O)[O-].C[NH+](C)CCCS(=O)(=O)O.
What is the InChIKey of dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate?
The InChIKey is LWCYHXZGIKLQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO3S.C4H6O2/c1-6(2)4-3-5-10(7,8)9;1-3(2)4(5)6/h3-5H2,1-2H3,(H,7,8,9);1H2,2H3,(H,5,6).
What are the key properties of dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate?
dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate has a molecular weight of 253.32 g/mol, XLogP of -2.28, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(3-sulfopropyl)azanium;2-methylprop-2-enoate is sourced from PubChem (CID 159473798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).