C20H33NO5Si — CID 15947417
(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 15947417) has the molecular formula C20H33NO5Si and a molecular weight of 395.57 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 15947417 |
| Molecular Formula | C20H33NO5Si |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H33NO5Si/c1-19(2,3)25-18(24)21-15(17(22)23)16(14-12-10-9-11-13-14)26-27(7,8)20(4,5)6/h9-13,15-16H,1-8H3,(H,21,24)(H,22,23)/t15-,16-/m0/s1 |
| InChIKey | TYHCXDMIFQPIQH-HOTGVXAUSA-N |
| XLogP | 4.73 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|