C24H18BNO3S — CID 159474235
boric acid;9-phenyl-12H-[1]benzothiolo[3,2-a]carbazole (PubChem CID 159474235) has the molecular formula C24H18BNO3S and a molecular weight of 411.29 g/mol. Its IUPAC name is boric acid;9-phenyl-12H-[1]benzothiolo[3,2-a]carbazole.
| Compound Name | boric acid;9-phenyl-12H-[1]benzothiolo[3,2-a]carbazole |
|---|---|
| PubChem CID | 159474235 |
| Molecular Formula | C24H18BNO3S |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | boric acid;9-phenyl-12H-[1]benzothiolo[3,2-a]carbazole |
| SMILES | OB(O)O.c1ccc(-c2ccc3[nH]c4c(ccc5sc6ccccc6c54)c3c2)cc1 |
| InChI | InChI=1S/C24H15NS.BH3O3/c1-2-6-15(7-3-1)16-10-12-20-19(14-16)17-11-13-22-23(24(17)25-20)18-8-4-5-9-21(18)26-22;2-1(3)4/h1-14,25H;2-4H |
| InChIKey | LWEHWDFWJXWQPW-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|