About 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol
6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol (PubChem CID 15947586) has the molecular formula C34H36N2O3
and a molecular weight of 520.67 g/mol. Its IUPAC name is 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol.
Molecular Properties
| Compound Name | 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol |
| PubChem CID | 15947586 |
| Molecular Formula | C34H36N2O3 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol |
| SMILES | COc1nc2ccc(-c3ccco3)cc2cc1C(c1ccccc1)C(O)(CCCCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C34H36N2O3/c1-36(2)21-11-10-20-34(37,28-15-8-5-9-16-28)32(25-13-6-4-7-14-25)29-24-27-23-26(31-17-12-22-39-31)18-19-30(27)35-33(29)38-3/h4-9,12-19,22-24,32,37H,10-11,20-21H2,1-3H3 |
| InChIKey | FTZDPUOVJKGSJM-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol?
The IUPAC name of 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol (CID 15947586) is 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol.
What is the SMILES notation for 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol?
The canonical SMILES for 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol is COc1nc2ccc(-c3ccco3)cc2cc1C(c1ccccc1)C(O)(CCCCN(C)C)c1ccccc1.
What is the InChIKey of 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol?
The InChIKey is FTZDPUOVJKGSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H36N2O3/c1-36(2)21-11-10-20-34(37,28-15-8-5-9-16-28)32(25-13-6-4-7-14-25)29-24-27-23-26(31-17-12-22-39-31)18-19-30(27)35-33(29)38-3/h4-9,12-19,22-24,32,37H,10-11,20-21H2,1-3H3.
What are the key properties of 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol?
6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol has a molecular weight of 520.67 g/mol, XLogP of 7.26, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dimethylamino)-1-[6-(furan-2-yl)-2-methoxyquinolin-3-yl]-1,2-diphenylhexan-2-ol is sourced from PubChem (CID 15947586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).