C23H46N6 — CID 159475883
2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane;2,5-dimethyl-2,5-diazabicyclo[2.2.2]octane;3,8-dimethyl-3,8-diazabicyclo[3.2.1]octane (PubChem CID 159475883) has the molecular formula C23H46N6 and a molecular weight of 406.66 g/mol. Its IUPAC name is 2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane;2,5-dimethyl-2,5-diazabicyclo[2.2.2]octane;3,8-dimethyl-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane;2,5-dimethyl-2,5-diazabicyclo[2.2.2]octane;3,8-dimethyl-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 159475883 |
| Molecular Formula | C23H46N6 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.38 |
| IUPAC Name | 2,5-dimethyl-2,5-diazabicyclo[2.2.1]heptane;2,5-dimethyl-2,5-diazabicyclo[2.2.2]octane;3,8-dimethyl-3,8-diazabicyclo[3.2.1]octane |
| SMILES | CN1CC2CC1CN2C.CN1CC2CCC(C1)N2C.CN1CC2CCC1CN2C |
| InChI | InChI=1S/2C8H16N2.C7H14N2/c1-9-5-8-4-3-7(9)6-10(8)2;1-9-5-7-3-4-8(6-9)10(7)2;1-8-4-7-3-6(8)5-9(7)2/h2*7-8H,3-6H2,1-2H3;6-7H,3-5H2,1-2H3 |
| InChIKey | LWJKKMHRZBLDDC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |