About 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine
1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine (PubChem CID 159476543) has the molecular formula C10H18F3N5
and a molecular weight of 265.28 g/mol. Its IUPAC name is 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine.
Molecular Properties
| Compound Name | 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine |
| PubChem CID | 159476543 |
| Molecular Formula | C10H18F3N5 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine |
| SMILES | CN1CCNCC1.NC1N=CC=CN1C(F)(F)F |
| InChI | InChI=1S/C5H6F3N3.C5H12N2/c6-5(7,8)11-3-1-2-10-4(11)9;1-7-4-2-6-3-5-7/h1-4H,9H2;6H,2-5H2,1H3 |
| InChIKey | LWLLQLJIBYTSJC-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine?
The IUPAC name of 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine (CID 159476543) is 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine.
What is the SMILES notation for 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine?
The canonical SMILES for 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine is CN1CCNCC1.NC1N=CC=CN1C(F)(F)F.
What is the InChIKey of 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine?
The InChIKey is LWLLQLJIBYTSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F3N3.C5H12N2/c6-5(7,8)11-3-1-2-10-4(11)9;1-7-4-2-6-3-5-7/h1-4H,9H2;6H,2-5H2,1H3.
What are the key properties of 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine?
1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine has a molecular weight of 265.28 g/mol, XLogP of 0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperazine;1-(trifluoromethyl)-2H-pyrimidin-2-amine is sourced from PubChem (CID 159476543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).