About 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium
2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium (PubChem CID 159477916) has the molecular formula C12H17NO3Y-2
and a molecular weight of 312.18 g/mol. Its IUPAC name is 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium.
Molecular Properties
| Compound Name | 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium |
| PubChem CID | 159477916 |
| Molecular Formula | C12H17NO3Y-2 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium |
| SMILES | CC(C)(C)[C-]=O.[CH2-]CCN1C(=O)C=CC1=O.[Y] |
| InChI | InChI=1S/C7H8NO2.C5H9O.Y/c1-2-5-8-6(9)3-4-7(8)10;1-5(2,3)4-6;/h3-4H,1-2,5H2;1-3H3;/q2*-1; |
| InChIKey | TXZRPRNAJPSEAX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium?
The IUPAC name of 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium (CID 159477916) is 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium.
What is the SMILES notation for 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium?
The canonical SMILES for 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium is CC(C)(C)[C-]=O.[CH2-]CCN1C(=O)C=CC1=O.[Y].
What is the InChIKey of 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium?
The InChIKey is TXZRPRNAJPSEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8NO2.C5H9O.Y/c1-2-5-8-6(9)3-4-7(8)10;1-5(2,3)4-6;/h3-4H,1-2,5H2;1-3H3;/q2*-1;.
What are the key properties of 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium?
2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium has a molecular weight of 312.18 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropan-1-one;1-propylpyrrole-2,5-dione;yttrium is sourced from PubChem (CID 159477916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).