C23H20ClN5O2 — CID 159478173
2-(3-chlorophenyl)-5-[2-(4-isocyanophenyl)acetyl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 159478173) has the molecular formula C23H20ClN5O2 and a molecular weight of 433.90 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-[2-(4-isocyanophenyl)acetyl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | 2-(3-chlorophenyl)-5-[2-(4-isocyanophenyl)acetyl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 159478173 |
| Molecular Formula | C23H20ClN5O2 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(3-chlorophenyl)-5-[2-(4-isocyanophenyl)acetyl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(CC(=O)N2Cc3c(C(N)=O)c(-c4cccc(Cl)c4)nn3CC2C)cc1 |
| InChI | InChI=1S/C23H20ClN5O2/c1-14-12-29-19(13-28(14)20(30)10-15-6-8-18(26-2)9-7-15)21(23(25)31)22(27-29)16-4-3-5-17(24)11-16/h3-9,11,14H,10,12-13H2,1H3,(H2,25,31) |
| InChIKey | LWQOVZJPXMUWQY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|