About 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium
3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium (PubChem CID 159478462) has the molecular formula C10H11IrN3
and a molecular weight of 365.44 g/mol. Its IUPAC name is 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium.
Molecular Properties
| Compound Name | 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium |
| PubChem CID | 159478462 |
| Molecular Formula | C10H11IrN3 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium |
| SMILES | Cc1cnc(-c2ccn[nH]2)c(C)c1.[Ir] |
| InChI | InChI=1S/C10H11N3.Ir/c1-7-5-8(2)10(11-6-7)9-3-4-12-13-9;/h3-6H,1-2H3,(H,12,13); |
| InChIKey | LWRLMWAWXJMNHA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium?
The IUPAC name of 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium (CID 159478462) is 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium.
What is the SMILES notation for 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium?
The canonical SMILES for 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium is Cc1cnc(-c2ccn[nH]2)c(C)c1.[Ir].
What is the InChIKey of 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium?
The InChIKey is LWRLMWAWXJMNHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3.Ir/c1-7-5-8(2)10(11-6-7)9-3-4-12-13-9;/h3-6H,1-2H3,(H,12,13);.
What are the key properties of 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium?
3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium has a molecular weight of 365.44 g/mol, XLogP of 2.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-(1H-pyrazol-5-yl)pyridine;iridium is sourced from PubChem (CID 159478462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).