About ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine
ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine (PubChem CID 159478755) has the molecular formula C28H39N5
and a molecular weight of 445.66 g/mol. Its IUPAC name is ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine.
Molecular Properties
| Compound Name | ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine |
| PubChem CID | 159478755 |
| Molecular Formula | C28H39N5 |
| Molecular Weight | 445.66 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine |
| SMILES | C/C(=C\c1ccccc1)c1ccccn1.CC.CC.CC.Cn1nnnc1-c1ccccc1 |
| InChI | InChI=1S/C14H13N.C8H8N4.3C2H6/c1-12(14-9-5-6-10-15-14)11-13-7-3-2-4-8-13;1-12-8(9-10-11-12)7-5-3-2-4-6-7;3*1-2/h2-11H,1H3;2-6H,1H3;3*1-2H3/b12-11+;;;; |
| InChIKey | LWSNQVIQSXSONE-MOSUJMLHSA-N |
| XLogP | 7.60 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.66 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine?
The IUPAC name of ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine (CID 159478755) is ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine.
What is the SMILES notation for ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine?
The canonical SMILES for ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine is C/C(=C\c1ccccc1)c1ccccn1.CC.CC.CC.Cn1nnnc1-c1ccccc1.
What is the InChIKey of ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine?
The InChIKey is LWSNQVIQSXSONE-MOSUJMLHSA-N. The full InChI is InChI=1S/C14H13N.C8H8N4.3C2H6/c1-12(14-9-5-6-10-15-14)11-13-7-3-2-4-8-13;1-12-8(9-10-11-12)7-5-3-2-4-6-7;3*1-2/h2-11H,1H3;2-6H,1H3;3*1-2H3/b12-11+;;;;.
What are the key properties of ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine?
ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine has a molecular weight of 445.66 g/mol, XLogP of 7.60, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-5-phenyltetrazole;2-[(E)-1-phenylprop-1-en-2-yl]pyridine is sourced from PubChem (CID 159478755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).