C26H29NO5 — CID 159479298
N-methoxy-N,3-dimethyl-1-benzofuran-2-carboxamide;3-methyl-1-(3-methyl-1-benzofuran-2-yl)butan-1-one (PubChem CID 159479298) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-methoxy-N,3-dimethyl-1-benzofuran-2-carboxamide;3-methyl-1-(3-methyl-1-benzofuran-2-yl)butan-1-one.
| Compound Name | N-methoxy-N,3-dimethyl-1-benzofuran-2-carboxamide;3-methyl-1-(3-methyl-1-benzofuran-2-yl)butan-1-one |
|---|---|
| PubChem CID | 159479298 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | N-methoxy-N,3-dimethyl-1-benzofuran-2-carboxamide;3-methyl-1-(3-methyl-1-benzofuran-2-yl)butan-1-one |
| SMILES | CON(C)C(=O)c1oc2ccccc2c1C.Cc1c(C(=O)CC(C)C)oc2ccccc12 |
| InChI | InChI=1S/C14H16O2.C12H13NO3/c1-9(2)8-12(15)14-10(3)11-6-4-5-7-13(11)16-14;1-8-9-6-4-5-7-10(9)16-11(8)12(14)13(2)15-3/h4-7,9H,8H2,1-3H3;4-7H,1-3H3 |
| InChIKey | LWUJDGNRDJBVLP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|