C25H17Cl3F6N4O2 — CID 159479838
2-chloro-6-(2-methoxyethoxy)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine;2,6-dichloro-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine (PubChem CID 159479838) has the molecular formula C25H17Cl3F6N4O2 and a molecular weight of 625.78 g/mol. Its IUPAC name is 2-chloro-6-(2-methoxyethoxy)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine;2,6-dichloro-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine.
| Compound Name | 2-chloro-6-(2-methoxyethoxy)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine;2,6-dichloro-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine |
|---|---|
| PubChem CID | 159479838 |
| Molecular Formula | C25H17Cl3F6N4O2 |
| Molecular Weight | 625.78 g/mol |
| Exact Mass | 624.03 |
| IUPAC Name | 2-chloro-6-(2-methoxyethoxy)-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine;2,6-dichloro-4-[6-(trifluoromethyl)-3-pyridinyl]pyridine |
| SMILES | COCCOc1cc(-c2ccc(C(F)(F)F)nc2)cc(Cl)n1.FC(F)(F)c1ccc(-c2cc(Cl)nc(Cl)c2)cn1 |
| InChI | InChI=1S/C14H12ClF3N2O2.C11H5Cl2F3N2/c1-21-4-5-22-13-7-10(6-12(15)20-13)9-2-3-11(19-8-9)14(16,17)18;12-9-3-7(4-10(13)18-9)6-1-2-8(17-5-6)11(14,15)16/h2-3,6-8H,4-5H2,1H3;1-5H |
| InChIKey | LWWAIOPZYIJFMA-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.78 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|