C22H24N4O — CID 159480061
2-[1-[(3-aminophenyl)methyl]-5-methylpyrazol-3-yl]-1-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanone (PubChem CID 159480061) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[1-[(3-aminophenyl)methyl]-5-methylpyrazol-3-yl]-1-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanone.
| Compound Name | 2-[1-[(3-aminophenyl)methyl]-5-methylpyrazol-3-yl]-1-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanone |
|---|---|
| PubChem CID | 159480061 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[1-[(3-aminophenyl)methyl]-5-methylpyrazol-3-yl]-1-(1,2,3,4-tetrahydroisoquinolin-6-yl)ethanone |
| SMILES | Cc1cc(CC(=O)c2ccc3c(c2)CCNC3)nn1Cc1cccc(N)c1 |
| InChI | InChI=1S/C22H24N4O/c1-15-9-21(25-26(15)14-16-3-2-4-20(23)10-16)12-22(27)18-5-6-19-13-24-8-7-17(19)11-18/h2-6,9-11,24H,7-8,12-14,23H2,1H3 |
| InChIKey | SURNLXYQNLVBFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|