About 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole
2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole (PubChem CID 159480522) has the molecular formula C9H8N4O2
and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole |
| PubChem CID | 159480522 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole |
| SMILES | c1c[nH]c(-c2ncco2)n1.c1cnoc1 |
| InChI | InChI=1S/C6H5N3O.C3H3NO/c1-2-8-5(7-1)6-9-3-4-10-6;1-2-4-5-3-1/h1-4H,(H,7,8);1-3H |
| InChIKey | LWYDUHPDOGRGEL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole?
The IUPAC name of 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole (CID 159480522) is 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole.
What is the SMILES notation for 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole?
The canonical SMILES for 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole is c1c[nH]c(-c2ncco2)n1.c1cnoc1.
What is the InChIKey of 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole?
The InChIKey is LWYDUHPDOGRGEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O.C3H3NO/c1-2-8-5(7-1)6-9-3-4-10-6;1-2-4-5-3-1/h1-4H,(H,7,8);1-3H.
What are the key properties of 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole?
2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole has a molecular weight of 204.19 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-yl)-1,3-oxazole;1,2-oxazole is sourced from PubChem (CID 159480522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).