About 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole
7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole (PubChem CID 159481135) has the molecular formula C18H17BrF2N2O
and a molecular weight of 395.25 g/mol. Its IUPAC name is 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole.
Molecular Properties
| Compound Name | 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole |
| PubChem CID | 159481135 |
| Molecular Formula | C18H17BrF2N2O |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole |
| SMILES | FC(F)OC[C@@H]1CC[C@H](c2nc3c(ccc4cc(Br)ccc43)[nH]2)C1 |
| InChI | InChI=1S/C18H17BrF2N2O/c19-13-4-5-14-11(8-13)3-6-15-16(14)23-17(22-15)12-2-1-10(7-12)9-24-18(20)21/h3-6,8,10,12,18H,1-2,7,9H2,(H,22,23)/t10-,12+/m1/s1 |
| InChIKey | BMTXDGRSZTZLEZ-PWSUYJOCSA-N |
| XLogP | 5.60 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole?
The IUPAC name of 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole (CID 159481135) is 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole.
What is the SMILES notation for 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole?
The canonical SMILES for 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole is FC(F)OC[C@@H]1CC[C@H](c2nc3c(ccc4cc(Br)ccc43)[nH]2)C1.
What is the InChIKey of 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole?
The InChIKey is BMTXDGRSZTZLEZ-PWSUYJOCSA-N. The full InChI is InChI=1S/C18H17BrF2N2O/c19-13-4-5-14-11(8-13)3-6-15-16(14)23-17(22-15)12-2-1-10(7-12)9-24-18(20)21/h3-6,8,10,12,18H,1-2,7,9H2,(H,22,23)/t10-,12+/m1/s1.
What are the key properties of 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole?
7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole has a molecular weight of 395.25 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-[(1S,3R)-3-(difluoromethoxymethyl)cyclopentyl]-3H-benzo[e]benzimidazole is sourced from PubChem (CID 159481135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).