C21H21ClN5O5P — CID 159481436
[(1S,2S)-2-[7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-8-yl]cyclopropyl]methoxy-pyrrol-1-ylphosphinic acid (PubChem CID 159481436) has the molecular formula C21H21ClN5O5P and a molecular weight of 489.86 g/mol. Its IUPAC name is [(1S,2S)-2-[7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-8-yl]cyclopropyl]methoxy-pyrrol-1-ylphosphinic acid.
| Compound Name | [(1S,2S)-2-[7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-8-yl]cyclopropyl]methoxy-pyrrol-1-ylphosphinic acid |
|---|---|
| PubChem CID | 159481436 |
| Molecular Formula | C21H21ClN5O5P |
| Molecular Weight | 489.86 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | [(1S,2S)-2-[7-[2-(4-chlorophenoxy)ethyl]-6-oxo-1H-purin-8-yl]cyclopropyl]methoxy-pyrrol-1-ylphosphinic acid |
| SMILES | O=c1[nH]cnc2nc([C@H]3C[C@@H]3COP(=O)(O)n3cccc3)n(CCOc3ccc(Cl)cc3)c12 |
| InChI | InChI=1S/C21H21ClN5O5P/c22-15-3-5-16(6-4-15)31-10-9-27-18-19(23-13-24-21(18)28)25-20(27)17-11-14(17)12-32-33(29,30)26-7-1-2-8-26/h1-8,13-14,17H,9-12H2,(H,29,30)(H,23,24,28)/t14-,17+/m1/s1 |
| InChIKey | XKVODUQMWFKNME-PBHICJAKSA-N |
| XLogP | 3.42 |
| TPSA | 124.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|