C23H46O4Si2 — CID 15948201
[(4R,5R)-2,2-dimethyl-5-[(1R)-2-methylidene-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]methoxy-triethylsilane (PubChem CID 15948201) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is [(4R,5R)-2,2-dimethyl-5-[(1R)-2-methylidene-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]methoxy-triethylsilane.
| Compound Name | [(4R,5R)-2,2-dimethyl-5-[(1R)-2-methylidene-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]methoxy-triethylsilane |
|---|---|
| PubChem CID | 15948201 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | [(4R,5R)-2,2-dimethyl-5-[(1R)-2-methylidene-1-triethylsilyloxybut-3-enyl]-1,3-dioxolan-4-yl]methoxy-triethylsilane |
| SMILES | C=CC(=C)[C@@H](O[Si](CC)(CC)CC)[C@@H]1OC(C)(C)O[C@@H]1CO[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H46O4Si2/c1-11-19(8)21(27-29(15-5,16-6)17-7)22-20(25-23(9,10)26-22)18-24-28(12-2,13-3)14-4/h11,20-22H,1,8,12-18H2,2-7,9-10H3/t20-,21-,22-/m1/s1 |
| InChIKey | XTWAMQVVMHICQQ-YPAWHYETSA-N |
| XLogP | 6.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|