C21H20FNO3 — CID 159482288
2-[(4aR,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone (PubChem CID 159482288) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is 2-[(4aR,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aR,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 159482288 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-[(4aR,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone |
| SMILES | C[C@H]1OC[C@]2(c3ccccc3F)N=C(CC(=O)c3ccccc3)OC[C@H]12 |
| InChI | InChI=1S/C21H20FNO3/c1-14-17-12-25-20(11-19(24)15-7-3-2-4-8-15)23-21(17,13-26-14)16-9-5-6-10-18(16)22/h2-10,14,17H,11-13H2,1H3/t14-,17-,21-/m1/s1 |
| InChIKey | YGSMCUKQVFLNOS-SOIKWTOOSA-N |
| XLogP | 3.76 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |