C28H15Cl2F10NO3 — CID 159482830
trans-(1R,3R)-2,2-dichloro-N-[3-[2-[5-(3,3-difluoro-2-oxopropyl)-2,4-difluorophenyl]acetyl]-4,5-difluorophenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 159482830) has the molecular formula C28H15Cl2F10NO3 and a molecular weight of 674.32 g/mol. Its IUPAC name is trans-(1R,3R)-2,2-dichloro-N-[3-[2-[5-(3,3-difluoro-2-oxopropyl)-2,4-difluorophenyl]acetyl]-4,5-difluorophenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-2,2-dichloro-N-[3-[2-[5-(3,3-difluoro-2-oxopropyl)-2,4-difluorophenyl]acetyl]-4,5-difluorophenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 159482830 |
| Molecular Formula | C28H15Cl2F10NO3 |
| Molecular Weight | 674.32 g/mol |
| Exact Mass | 673.03 |
| IUPAC Name | trans-(1R,3R)-2,2-dichloro-N-[3-[2-[5-(3,3-difluoro-2-oxopropyl)-2,4-difluorophenyl]acetyl]-4,5-difluorophenyl]-3-[4-fluoro-3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Cc1cc(CC(=O)C(F)F)c(F)cc1F)c1cc(NC(=O)[C@H]2[C@H](c3ccc(F)c(C(F)(F)F)c3)C2(Cl)Cl)cc(F)c1F |
| InChI | InChI=1S/C28H15Cl2F10NO3/c29-27(30)22(10-1-2-16(31)15(4-10)28(38,39)40)23(27)26(44)41-13-7-14(24(35)19(34)8-13)20(42)5-11-3-12(6-21(43)25(36)37)18(33)9-17(11)32/h1-4,7-9,22-23,25H,5-6H2,(H,41,44)/t22-,23+/m0/s1 |
| InChIKey | LXFGFHKUZVDODY-XZOQPEGZSA-N |
| XLogP | 7.73 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.32 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|