C55H84N4O5SSi- — CID 159483614
CID 159483614 (PubChem CID 159483614) has the molecular formula C55H84N4O5SSi- and a molecular weight of 941.45 g/mol.
| Compound Name | CID 159483614 |
|---|---|
| PubChem CID | 159483614 |
| Molecular Formula | C55H84N4O5SSi- |
| Molecular Weight | 941.45 g/mol |
| Exact Mass | 940.59 |
| IUPAC Name | — |
| SMILES | C=C(C)[C@@H]1CC[C@]2(NCCN3CCS(=O)(=O)CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(C6=CCC(COc7cc(C#N)ccn7)(C(=O)O[Si-](C)(C)C(C)(C)C)CC6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C55H84N4O5SSi/c1-38(2)41-17-25-55(58-29-30-59-31-33-65(61,62)34-32-59)27-26-52(9)43(47(41)55)13-14-45-51(8)21-18-42(50(6,7)44(51)19-22-53(45,52)10)40-15-23-54(24-16-40,48(60)64-66(11,12)49(3,4)5)37-63-46-35-39(36-56)20-28-57-46/h15,18,20,28,35,41,43-45,47,58H,1,13-14,16-17,19,21-27,29-34,37H2,2-12H3/q-1/t41-,43+,44-,45+,47+,51-,52+,53+,54?,55-/m0/s1 |
| InChIKey | DZYFICQBWGEWBY-GQYLZUTBSA-N |
| XLogP | 11.24 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.45 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|