C15H32O3Si — CID 159483959
tert-butyl-[(2R,3R,4R,5S)-3-methoxy-2,5,6-trimethyloxan-4-yl]oxy-dimethylsilane (PubChem CID 159483959) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,4R,5S)-3-methoxy-2,5,6-trimethyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R,4R,5S)-3-methoxy-2,5,6-trimethyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 159483959 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | tert-butyl-[(2R,3R,4R,5S)-3-methoxy-2,5,6-trimethyloxan-4-yl]oxy-dimethylsilane |
| SMILES | CO[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(C)O[C@@H]1C |
| InChI | InChI=1S/C15H32O3Si/c1-10-11(2)17-12(3)14(16-7)13(10)18-19(8,9)15(4,5)6/h10-14H,1-9H3/t10-,11?,12+,13+,14+/m0/s1 |
| InChIKey | AQQABEALAGQYKY-ZOGNZRORSA-N |
| XLogP | 3.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|