C48H57NO5Si — CID 15948430
2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-7-methyl-3-trityloxyoct-6-en-2-yl]oxy-N,N-dimethylacetamide (PubChem CID 15948430) has the molecular formula C48H57NO5Si and a molecular weight of 756.07 g/mol. Its IUPAC name is 2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-7-methyl-3-trityloxyoct-6-en-2-yl]oxy-N,N-dimethylacetamide.
| Compound Name | 2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-7-methyl-3-trityloxyoct-6-en-2-yl]oxy-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 15948430 |
| Molecular Formula | C48H57NO5Si |
| Molecular Weight | 756.07 g/mol |
| Exact Mass | 755.40 |
| IUPAC Name | 2-[(E,2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-8-hydroxy-7-methyl-3-trityloxyoct-6-en-2-yl]oxy-N,N-dimethylacetamide |
| SMILES | C/C(=C\CC[C@@H](OC(c1ccccc1)(c1ccccc1)c1ccccc1)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCC(=O)N(C)C)CO |
| InChI | InChI=1S/C48H57NO5Si/c1-38(35-50)23-22-34-44(54-48(39-24-12-7-13-25-39,40-26-14-8-15-27-40)41-28-16-9-17-29-41)45(52-37-46(51)49(5)6)36-53-55(47(2,3)4,42-30-18-10-19-31-42)43-32-20-11-21-33-43/h7-21,23-33,44-45,50H,22,34-37H2,1-6H3/b38-23+/t44-,45-/m1/s1 |
| InChIKey | MXUQUYPKFIQGMP-RCDCKWOKSA-N |
| XLogP | 8.13 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.07 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|