C23H19F3N6O4 — CID 159485043
2-[[4-[[8-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzoyl]amino]ethylcarbamic acid (PubChem CID 159485043) has the molecular formula C23H19F3N6O4 and a molecular weight of 500.44 g/mol. Its IUPAC name is 2-[[4-[[8-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzoyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[4-[[8-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzoyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 159485043 |
| Molecular Formula | C23H19F3N6O4 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2-[[4-[[8-[3-(trifluoromethoxy)phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]benzoyl]amino]ethylcarbamic acid |
| SMILES | O=C(O)NCCNC(=O)c1ccc(Nc2nc3c(-c4cccc(OC(F)(F)F)c4)cccn3n2)cc1 |
| InChI | InChI=1S/C23H19F3N6O4/c24-23(25,26)36-17-4-1-3-15(13-17)18-5-2-12-32-19(18)30-21(31-32)29-16-8-6-14(7-9-16)20(33)27-10-11-28-22(34)35/h1-9,12-13,28H,10-11H2,(H,27,33)(H,29,31)(H,34,35) |
| InChIKey | LXLYSHSHABJFMY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|