About ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone
ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone (PubChem CID 159485305) has the molecular formula C20H24N4O3
and a molecular weight of 368.44 g/mol. Its IUPAC name is ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone.
Molecular Properties
| Compound Name | ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone |
| PubChem CID | 159485305 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone |
| SMILES | CC(=O)c1ccccn1.CCOC(C)=O.Cc1cc(-c2ccccn2)n[nH]1 |
| InChI | InChI=1S/C9H9N3.C7H7NO.C4H8O2/c1-7-6-9(12-11-7)8-4-2-3-5-10-8;1-6(9)7-4-2-3-5-8-7;1-3-6-4(2)5/h2-6H,1H3,(H,11,12);2-5H,1H3;3H2,1-2H3 |
| InChIKey | LXMUGHDZYLFIAC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone?
The IUPAC name of ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone (CID 159485305) is ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone.
What is the SMILES notation for ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone?
The canonical SMILES for ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone is CC(=O)c1ccccn1.CCOC(C)=O.Cc1cc(-c2ccccn2)n[nH]1.
What is the InChIKey of ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone?
The InChIKey is LXMUGHDZYLFIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.C7H7NO.C4H8O2/c1-7-6-9(12-11-7)8-4-2-3-5-10-8;1-6(9)7-4-2-3-5-8-7;1-3-6-4(2)5/h2-6H,1H3,(H,11,12);2-5H,1H3;3H2,1-2H3.
What are the key properties of ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone?
ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone has a molecular weight of 368.44 g/mol, XLogP of 3.63, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;2-(5-methyl-1H-pyrazol-3-yl)pyridine;1-pyridin-2-ylethanone is sourced from PubChem (CID 159485305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).