C46H50O4Si — CID 15948545
(2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carbaldehyde (PubChem CID 15948545) has the molecular formula C46H50O4Si and a molecular weight of 694.99 g/mol. Its IUPAC name is (2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carbaldehyde.
| Compound Name | (2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carbaldehyde |
|---|---|
| PubChem CID | 15948545 |
| Molecular Formula | C46H50O4Si |
| Molecular Weight | 694.99 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | (2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonine-9-carbaldehyde |
| SMILES | C/C1=C\CC[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](C=O)C1 |
| InChI | InChI=1S/C46H50O4Si/c1-36-21-20-32-43(50-46(37-22-10-5-11-23-37,38-24-12-6-13-25-38)39-26-14-7-15-27-39)44(49-40(33-36)34-47)35-48-51(45(2,3)4,41-28-16-8-17-29-41)42-30-18-9-19-31-42/h5-19,21-31,34,40,43-44H,20,32-33,35H2,1-4H3/b36-21+/t40-,43-,44-/m1/s1 |
| InChIKey | ZBNKLYSZCUVCIO-VLTDUTJUSA-N |
| XLogP | 9.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.99 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|