C49H54O4Si — CID 15948546
(E)-3-[(2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonin-9-yl]-2-methylprop-2-enal (PubChem CID 15948546) has the molecular formula C49H54O4Si and a molecular weight of 735.05 g/mol. Its IUPAC name is (E)-3-[(2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonin-9-yl]-2-methylprop-2-enal.
| Compound Name | (E)-3-[(2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonin-9-yl]-2-methylprop-2-enal |
|---|---|
| PubChem CID | 15948546 |
| Molecular Formula | C49H54O4Si |
| Molecular Weight | 735.05 g/mol |
| Exact Mass | 734.38 |
| IUPAC Name | (E)-3-[(2R,3R,6E,9R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-methyl-3-trityloxy-2,3,4,5,8,9-hexahydrooxonin-9-yl]-2-methylprop-2-enal |
| SMILES | C/C(C=O)=C\[C@H]1C/C(C)=C/CC[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C49H54O4Si/c1-38-22-21-33-46(53-49(40-23-11-6-12-24-40,41-25-13-7-14-26-41)42-27-15-8-16-28-42)47(52-43(34-38)35-39(2)36-50)37-51-54(48(3,4)5,44-29-17-9-18-30-44)45-31-19-10-20-32-45/h6-20,22-32,35-36,43,46-47H,21,33-34,37H2,1-5H3/b38-22+,39-35+/t43-,46-,47-/m1/s1 |
| InChIKey | KSRORLIFPBUKHY-FTEBQTHASA-N |
| XLogP | 9.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.05 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|