C25H26N2O2 — CID 159486441
2-(2-naphthalen-2-yl-1H-indol-3-yl)acetic acid;piperidine (PubChem CID 159486441) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(2-naphthalen-2-yl-1H-indol-3-yl)acetic acid;piperidine.
| Compound Name | 2-(2-naphthalen-2-yl-1H-indol-3-yl)acetic acid;piperidine |
|---|---|
| PubChem CID | 159486441 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-(2-naphthalen-2-yl-1H-indol-3-yl)acetic acid;piperidine |
| SMILES | C1CCNCC1.O=C(O)Cc1c(-c2ccc3ccccc3c2)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H15NO2.C5H11N/c22-19(23)12-17-16-7-3-4-8-18(16)21-20(17)15-10-9-13-5-1-2-6-14(13)11-15;1-2-4-6-5-3-1/h1-11,21H,12H2,(H,22,23);6H,1-5H2 |
| InChIKey | LXQKBIZWSUTYPT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |