C28H50O5Si — CID 15948769
[(1R,2R,3R,7R,8R,10S,11S,14R)-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate (PubChem CID 15948769) has the molecular formula C28H50O5Si and a molecular weight of 494.79 g/mol. Its IUPAC name is [(1R,2R,3R,7R,8R,10S,11S,14R)-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate.
| Compound Name | [(1R,2R,3R,7R,8R,10S,11S,14R)-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
|---|---|
| PubChem CID | 15948769 |
| Molecular Formula | C28H50O5Si |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [(1R,2R,3R,7R,8R,10S,11S,14R)-10-hydroxy-6,10,14-trimethyl-3-propan-2-yl-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC[C@H](OC(C)=O)[C@@](C)(O)C[C@H]2O[C@@H]1[C@H]1[C@@H]2C(C)=CC[C@@H]1C(C)C |
| InChI | InChI=1S/C28H50O5Si/c1-10-34(11-2,12-3)33-28(9)16-15-23(31-20(7)29)27(8,30)17-22-24-19(6)13-14-21(18(4)5)25(24)26(28)32-22/h13,18,21-26,30H,10-12,14-17H2,1-9H3/t21-,22-,23+,24-,25-,26-,27+,28-/m1/s1 |
| InChIKey | VYDHGINKWLXTSD-XQOQTTFGSA-N |
| XLogP | 6.26 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|