C29H59NO — CID 159488669
tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine;4-tert-butyloxane (PubChem CID 159488669) has the molecular formula C29H59NO and a molecular weight of 437.80 g/mol. Its IUPAC name is tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine;4-tert-butyloxane.
| Compound Name | tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine;4-tert-butyloxane |
|---|---|
| PubChem CID | 159488669 |
| Molecular Formula | C29H59NO |
| Molecular Weight | 437.80 g/mol |
| Exact Mass | 437.46 |
| IUPAC Name | tert-butylcyclohexane;4-tert-butyl-1-methylpiperidine;4-tert-butyloxane |
| SMILES | CC(C)(C)C1CCCCC1.CC(C)(C)C1CCOCC1.CN1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C10H21N.C10H20.C9H18O/c1-10(2,3)9-5-7-11(4)8-6-9;1-10(2,3)9-7-5-4-6-8-9;1-9(2,3)8-4-6-10-7-5-8/h9H,5-8H2,1-4H3;9H,4-8H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | LXXFKNPZFFKIQV-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.80 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |