C29H35ClN6O5 — CID 15948924
tert-butyl (2R,5R)-2-[2-(3-chloro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-5-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]piperidine-1-carboxylate (PubChem CID 15948924) has the molecular formula C29H35ClN6O5 and a molecular weight of 583.09 g/mol. Its IUPAC name is tert-butyl (2R,5R)-2-[2-(3-chloro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-5-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,5R)-2-[2-(3-chloro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-5-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 15948924 |
| Molecular Formula | C29H35ClN6O5 |
| Molecular Weight | 583.09 g/mol |
| Exact Mass | 582.24 |
| IUPAC Name | tert-butyl (2R,5R)-2-[2-(3-chloro-6-methoxy-1,5-naphthyridin-4-yl)ethyl]-5-[(3-oxo-4H-pyrido[3,2-b][1,4]oxazin-6-yl)methylamino]piperidine-1-carboxylate |
| SMILES | COc1ccc2ncc(Cl)c(CC[C@@H]3CC[C@@H](NCc4ccc5c(n4)NC(=O)CO5)CN3C(=O)OC(C)(C)C)c2n1 |
| InChI | InChI=1S/C29H35ClN6O5/c1-29(2,3)41-28(38)36-15-18(31-13-17-6-11-23-27(33-17)34-24(37)16-40-23)5-7-19(36)8-9-20-21(30)14-32-22-10-12-25(39-4)35-26(20)22/h6,10-12,14,18-19,31H,5,7-9,13,15-16H2,1-4H3,(H,33,34,37)/t18-,19+/m1/s1 |
| InChIKey | JOWSTDWJUQLCJZ-MOPGFXCFSA-N |
| XLogP | 4.51 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.09 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |