About 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane
1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane (PubChem CID 159489336) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane.
Molecular Properties
| Compound Name | 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane |
| PubChem CID | 159489336 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane |
| SMILES | CC1C(CCC(C)(C)C)C1C(C)(C)C |
| InChI | InChI=1S/C14H28/c1-10-11(8-9-13(2,3)4)12(10)14(5,6)7/h10-12H,8-9H2,1-7H3 |
| InChIKey | YWKYTPVZKCMQSB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane?
The IUPAC name of 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane (CID 159489336) is 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane.
What is the SMILES notation for 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane?
The canonical SMILES for 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane is CC1C(CCC(C)(C)C)C1C(C)(C)C.
What is the InChIKey of 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane?
The InChIKey is YWKYTPVZKCMQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-10-11(8-9-13(2,3)4)12(10)14(5,6)7/h10-12H,8-9H2,1-7H3.
What are the key properties of 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane?
1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane has a molecular weight of 196.38 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2-(3,3-dimethylbutyl)-3-methylcyclopropane is sourced from PubChem (CID 159489336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).