About lithium;1,1'-biphenyl;methanidylbenzene
lithium;1,1'-biphenyl;methanidylbenzene (PubChem CID 159489560) has the molecular formula C19H17Li
and a molecular weight of 252.29 g/mol. Its IUPAC name is lithium;1,1'-biphenyl;methanidylbenzene.
Molecular Properties
| Compound Name | lithium;1,1'-biphenyl;methanidylbenzene |
| PubChem CID | 159489560 |
| Molecular Formula | C19H17Li |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | lithium;1,1'-biphenyl;methanidylbenzene |
| SMILES | [CH2-]c1ccccc1.[Li+].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C7H7.Li/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7-5-3-2-4-6-7;/h1-10H;2-6H,1H2;/q;-1;+1 |
| InChIKey | DJPININCZUWMSH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;1,1'-biphenyl;methanidylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,1'-biphenyl;methanidylbenzene?
The IUPAC name of lithium;1,1'-biphenyl;methanidylbenzene (CID 159489560) is lithium;1,1'-biphenyl;methanidylbenzene.
What is the SMILES notation for lithium;1,1'-biphenyl;methanidylbenzene?
The canonical SMILES for lithium;1,1'-biphenyl;methanidylbenzene is [CH2-]c1ccccc1.[Li+].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of lithium;1,1'-biphenyl;methanidylbenzene?
The InChIKey is DJPININCZUWMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C7H7.Li/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-7-5-3-2-4-6-7;/h1-10H;2-6H,1H2;/q;-1;+1.
What are the key properties of lithium;1,1'-biphenyl;methanidylbenzene?
lithium;1,1'-biphenyl;methanidylbenzene has a molecular weight of 252.29 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,1'-biphenyl;methanidylbenzene is sourced from PubChem (CID 159489560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).