C27H27Cl2N5O3S — CID 159490516
5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;1-(hydroperoxymethyl)-4-methylbenzene (PubChem CID 159490516) has the molecular formula C27H27Cl2N5O3S and a molecular weight of 572.52 g/mol. Its IUPAC name is 5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;1-(hydroperoxymethyl)-4-methylbenzene.
| Compound Name | 5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;1-(hydroperoxymethyl)-4-methylbenzene |
|---|---|
| PubChem CID | 159490516 |
| Molecular Formula | C27H27Cl2N5O3S |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 5-chloro-N-[2-[5-(2-chlorophenyl)-1,4-dimethylpyrazol-3-yl]oxyethyl]thieno[2,3-d]pyrimidin-4-amine;1-(hydroperoxymethyl)-4-methylbenzene |
| SMILES | Cc1c(OCCNc2ncnc3scc(Cl)c23)nn(C)c1-c1ccccc1Cl.Cc1ccc(COO)cc1 |
| InChI | InChI=1S/C19H17Cl2N5OS.C8H10O2/c1-11-16(12-5-3-4-6-13(12)20)26(2)25-18(11)27-8-7-22-17-15-14(21)9-28-19(15)24-10-23-17;1-7-2-4-8(5-3-7)6-10-9/h3-6,9-10H,7-8H2,1-2H3,(H,22,23,24);2-5,9H,6H2,1H3 |
| InChIKey | LYDBMIPRBSZMKZ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|