About CID 159491699
CID 159491699 (PubChem CID 159491699) has the molecular formula C28H50N6Sr
and a molecular weight of 558.37 g/mol.
Molecular Properties
| Compound Name | CID 159491699 |
| PubChem CID | 159491699 |
| Molecular Formula | C28H50N6Sr |
| Molecular Weight | 558.37 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | — |
| SMILES | CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.[Sr] |
| InChI | InChI=1S/2C14H25N3.Sr/c2*1-9-10(2)12(17-14(6,7)8)15-11(9)16-13(3,4)5;/h2*1-8H3,(H,15,16,17); |
| InChIKey | LYGQZRAQGBVJFE-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 558.37 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 159491699 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159491699?
The IUPAC name of CID 159491699 (CID 159491699) is not available.
What is the SMILES notation for CID 159491699?
The canonical SMILES for CID 159491699 is CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.CC1=C(C)/C(=N\C(C)(C)C)N/C1=N/C(C)(C)C.[Sr].
What is the InChIKey of CID 159491699?
The InChIKey is LYGQZRAQGBVJFE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C14H25N3.Sr/c2*1-9-10(2)12(17-14(6,7)8)15-11(9)16-13(3,4)5;/h2*1-8H3,(H,15,16,17);.
What are the key properties of CID 159491699?
CID 159491699 has a molecular weight of 558.37 g/mol, XLogP of 6.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159491699 is sourced from PubChem (CID 159491699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).