C23H20ClF3N4O3S — CID 15949273
ethyl 1-[3-chloro-5-[[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-pyridinyl]piperidine-4-carboxylate (PubChem CID 15949273) has the molecular formula C23H20ClF3N4O3S and a molecular weight of 524.95 g/mol. Its IUPAC name is ethyl 1-[3-chloro-5-[[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-pyridinyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-chloro-5-[[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-pyridinyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 15949273 |
| Molecular Formula | C23H20ClF3N4O3S |
| Molecular Weight | 524.95 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | ethyl 1-[3-chloro-5-[[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]carbamoyl]-2-pyridinyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncc(C(=O)Nc3nc(-c4ccc(F)c(F)c4F)cs3)cc2Cl)CC1 |
| InChI | InChI=1S/C23H20ClF3N4O3S/c1-2-34-22(33)12-5-7-31(8-6-12)20-15(24)9-13(10-28-20)21(32)30-23-29-17(11-35-23)14-3-4-16(25)19(27)18(14)26/h3-4,9-12H,2,5-8H2,1H3,(H,29,30,32) |
| InChIKey | XWVAHENPSSGHGR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.95 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|