About bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane
bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane (PubChem CID 159492818) has the molecular formula C24H38O7Si2
and a molecular weight of 494.73 g/mol. Its IUPAC name is bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane.
Molecular Properties
| Compound Name | bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane |
| PubChem CID | 159492818 |
| Molecular Formula | C24H38O7Si2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane |
| SMILES | C[Si](C)(C)O[Si](C)(C)C.O=C1OC(=O)C2C3CCC(C3)C12.O=C1OC(=O)C2C3CCC(C3)C12 |
| InChI | InChI=1S/2C9H10O3.C6H18OSi2/c2*10-8-6-4-1-2-5(3-4)7(6)9(11)12-8;1-8(2,3)7-9(4,5)6/h2*4-7H,1-3H2;1-6H3 |
| InChIKey | LYKHJCQHONMMPY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane?
The IUPAC name of bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane (CID 159492818) is bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane.
What is the SMILES notation for bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane?
The canonical SMILES for bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane is C[Si](C)(C)O[Si](C)(C)C.O=C1OC(=O)C2C3CCC(C3)C12.O=C1OC(=O)C2C3CCC(C3)C12.
What is the InChIKey of bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane?
The InChIKey is LYKHJCQHONMMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H10O3.C6H18OSi2/c2*10-8-6-4-1-2-5(3-4)7(6)9(11)12-8;1-8(2,3)7-9(4,5)6/h2*4-7H,1-3H2;1-6H3.
What are the key properties of bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane?
bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane has a molecular weight of 494.73 g/mol, XLogP of 4.14, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-oxatricyclo[5.2.1.02,6]decane-3,5-dione);trimethyl(trimethylsilyloxy)silane is sourced from PubChem (CID 159492818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).