C17H26N2O3 — CID 159492930
tert-butyl (3R,6R,8aS)-3-methyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate (PubChem CID 159492930) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl (3R,6R,8aS)-3-methyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate.
| Compound Name | tert-butyl (3R,6R,8aS)-3-methyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 159492930 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl (3R,6R,8aS)-3-methyl-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1'-carboxylate |
| SMILES | C[C@@H]1CC[C@H]2C=C[C@]3(CCCN3C(=O)OC(C)(C)C)C(=O)N12 |
| InChI | InChI=1S/C17H26N2O3/c1-12-6-7-13-8-10-17(14(20)19(12)13)9-5-11-18(17)15(21)22-16(2,3)4/h8,10,12-13H,5-7,9,11H2,1-4H3/t12-,13+,17-/m1/s1 |
| InChIKey | MHJNGCPUXRVEMZ-IIYDPXPESA-N |
| XLogP | 2.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|