About 4-iminopentan-2-one;pentane-2,4-dione
4-iminopentan-2-one;pentane-2,4-dione (PubChem CID 159492955) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-iminopentan-2-one;pentane-2,4-dione.
Molecular Properties
| Compound Name | 4-iminopentan-2-one;pentane-2,4-dione |
| PubChem CID | 159492955 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 4-iminopentan-2-one;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.[H]/N=C(\C)CC(C)=O |
| InChI | InChI=1S/C5H9NO.C5H8O2/c2*1-4(6)3-5(2)7/h6H,3H2,1-2H3;3H2,1-2H3/b6-4+; |
| InChIKey | LYKSGYQAQITHBJ-CVDVRWGVSA-N |
| XLogP | 1.56 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminopentan-2-one;pentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminopentan-2-one;pentane-2,4-dione?
The IUPAC name of 4-iminopentan-2-one;pentane-2,4-dione (CID 159492955) is 4-iminopentan-2-one;pentane-2,4-dione.
What is the SMILES notation for 4-iminopentan-2-one;pentane-2,4-dione?
The canonical SMILES for 4-iminopentan-2-one;pentane-2,4-dione is CC(=O)CC(C)=O.[H]/N=C(\C)CC(C)=O.
What is the InChIKey of 4-iminopentan-2-one;pentane-2,4-dione?
The InChIKey is LYKSGYQAQITHBJ-CVDVRWGVSA-N. The full InChI is InChI=1S/C5H9NO.C5H8O2/c2*1-4(6)3-5(2)7/h6H,3H2,1-2H3;3H2,1-2H3/b6-4+;.
What are the key properties of 4-iminopentan-2-one;pentane-2,4-dione?
4-iminopentan-2-one;pentane-2,4-dione has a molecular weight of 199.25 g/mol, XLogP of 1.56, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminopentan-2-one;pentane-2,4-dione is sourced from PubChem (CID 159492955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).