C28H31BrO2 — CID 159493149
5-bromo-2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one;2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one (PubChem CID 159493149) has the molecular formula C28H31BrO2 and a molecular weight of 479.46 g/mol. Its IUPAC name is 5-bromo-2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one;2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one.
| Compound Name | 5-bromo-2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one;2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one |
|---|---|
| PubChem CID | 159493149 |
| Molecular Formula | C28H31BrO2 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 5-bromo-2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one;2-methyl-1,2,6,7,8,9-hexahydrocyclopenta[a]naphthalen-3-one |
| SMILES | CC1Cc2c(cc(Br)c3c2CCCC3)C1=O.CC1Cc2c(ccc3c2CCCC3)C1=O |
| InChI | InChI=1S/C14H15BrO.C14H16O/c1-8-6-11-9-4-2-3-5-10(9)13(15)7-12(11)14(8)16;1-9-8-13-11-5-3-2-4-10(11)6-7-12(13)14(9)15/h7-8H,2-6H2,1H3;6-7,9H,2-5,8H2,1H3 |
| InChIKey | LYLHXKWYRJQSMQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |