C11H16O2 — CID 159493384
methane;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 159493384) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is methane;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | methane;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 159493384 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | methane;2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C.CC1=C(C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C10H12O2.CH4/c1-5-6(2)10(12)8(4)7(3)9(5)11;/h1-4H3;1H4 |
| InChIKey | LYLYTBFDFUXVSO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|