C18H19F3N4 — CID 15949418
(1S,2R,5S)-5-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 15949418) has the molecular formula C18H19F3N4 and a molecular weight of 348.37 g/mol. Its IUPAC name is (1S,2R,5S)-5-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (1S,2R,5S)-5-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 15949418 |
| Molecular Formula | C18H19F3N4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (1S,2R,5S)-5-(5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cncnc3C2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H19F3N4/c19-14-5-16(21)15(20)4-13(14)12-2-1-11(3-17(12)22)25-7-10-6-23-9-24-18(10)8-25/h4-6,9,11-12,17H,1-3,7-8,22H2/t11-,12+,17-/m0/s1 |
| InChIKey | QTMJMQHWIYCNRI-JKDFXYPNSA-N |
| XLogP | 2.87 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|