C22H16ClN3O5 — CID 15949483
2-[5-chloro-1'-(1H-indol-3-ylmethyl)-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid (PubChem CID 15949483) has the molecular formula C22H16ClN3O5 and a molecular weight of 437.84 g/mol. Its IUPAC name is 2-[5-chloro-1'-(1H-indol-3-ylmethyl)-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid.
| Compound Name | 2-[5-chloro-1'-(1H-indol-3-ylmethyl)-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
|---|---|
| PubChem CID | 15949483 |
| Molecular Formula | C22H16ClN3O5 |
| Molecular Weight | 437.84 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[5-chloro-1'-(1H-indol-3-ylmethyl)-2,2',5'-trioxospiro[indole-3,3'-pyrrolidine]-1-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2(CC(=O)N(Cc3c[nH]c4ccccc34)C2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H16ClN3O5/c23-13-5-6-17-15(7-13)22(20(30)25(17)11-19(28)29)8-18(27)26(21(22)31)10-12-9-24-16-4-2-1-3-14(12)16/h1-7,9,24H,8,10-11H2,(H,28,29) |
| InChIKey | NXGGINSWMFMGAF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.84 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|