C19H18F6N4 — CID 15949508
(1S,2R,5S)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine (PubChem CID 15949508) has the molecular formula C19H18F6N4 and a molecular weight of 416.37 g/mol. Its IUPAC name is (1S,2R,5S)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine.
| Compound Name | (1S,2R,5S)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 15949508 |
| Molecular Formula | C19H18F6N4 |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (1S,2R,5S)-5-[2-(trifluoromethyl)-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl]-2-(2,4,5-trifluorophenyl)cyclohexan-1-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cnc(C(F)(F)F)nc3C2)CC[C@@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H18F6N4/c20-13-5-15(22)14(21)4-12(13)11-2-1-10(3-16(11)26)29-7-9-6-27-18(19(23,24)25)28-17(9)8-29/h4-6,10-11,16H,1-3,7-8,26H2/t10-,11+,16-/m0/s1 |
| InChIKey | MWCJMPVQJUBGAL-USBNGQNGSA-N |
| XLogP | 3.89 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|