About [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium
[3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium (PubChem CID 159495116) has the molecular formula C15H17ClN4OY-2
and a molecular weight of 393.69 g/mol. Its IUPAC name is [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium.
Molecular Properties
| Compound Name | [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium |
| PubChem CID | 159495116 |
| Molecular Formula | C15H17ClN4OY-2 |
| Molecular Weight | 393.69 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium |
| SMILES | Cc1ccc(CNc2nc(N)c([C-]=O)nc2Cl)cc1.[CH2-]C.[Y] |
| InChI | InChI=1S/C13H12ClN4O.C2H5.Y/c1-8-2-4-9(5-3-8)6-16-13-11(14)17-10(7-19)12(15)18-13;1-2;/h2-5H,6H2,1H3,(H3,15,16,18);1H2,2H3;/q2*-1; |
| InChIKey | ARSSMFXFPYHDHD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.69 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium?
The IUPAC name of [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium (CID 159495116) is [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium.
What is the SMILES notation for [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium?
The canonical SMILES for [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium is Cc1ccc(CNc2nc(N)c([C-]=O)nc2Cl)cc1.[CH2-]C.[Y].
What is the InChIKey of [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium?
The InChIKey is ARSSMFXFPYHDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClN4O.C2H5.Y/c1-8-2-4-9(5-3-8)6-16-13-11(14)17-10(7-19)12(15)18-13;1-2;/h2-5H,6H2,1H3,(H3,15,16,18);1H2,2H3;/q2*-1;.
What are the key properties of [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium?
[3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium has a molecular weight of 393.69 g/mol, XLogP of 2.93, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-amino-6-chloro-5-[(4-methylphenyl)methylamino]pyrazin-2-yl]methanone;ethane;yttrium is sourced from PubChem (CID 159495116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).