About CID 159495878
CID 159495878 (PubChem CID 159495878) has the molecular formula C44H59BBr2IN8O6Si2
and a molecular weight of 1149.70 g/mol.
Molecular Properties
| Compound Name | CID 159495878 |
| PubChem CID | 159495878 |
| Molecular Formula | C44H59BBr2IN8O6Si2 |
| Molecular Weight | 1149.70 g/mol |
| Exact Mass | 1147.16 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccnc(N3CCOCC3)c2)c2cc(Br)ccc21.C[Si](C)(C)CCOCn1nc(I)c2cc(Br)ccc21.O[B]Oc1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C22H29BrN4O2Si.C13H18BrIN2OSi.C9H12BN2O3/c1-30(2,3)13-12-29-16-27-20-5-4-18(23)15-19(20)22(25-27)17-6-7-24-21(14-17)26-8-10-28-11-9-26;1-19(2,3)7-6-18-9-17-12-5-4-10(14)8-11(12)13(15)16-17;13-10-15-8-1-2-11-9(7-8)12-3-5-14-6-4-12/h4-7,14-15H,8-13,16H2,1-3H3;4-5,8H,6-7,9H2,1-3H3;1-2,7,13H,3-6H2 |
| InChIKey | NBEHBKDAWFEVIL-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 134.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1149.70 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 159495878 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159495878?
The IUPAC name of CID 159495878 (CID 159495878) is not available.
What is the SMILES notation for CID 159495878?
The canonical SMILES for CID 159495878 is C[Si](C)(C)CCOCn1nc(-c2ccnc(N3CCOCC3)c2)c2cc(Br)ccc21.C[Si](C)(C)CCOCn1nc(I)c2cc(Br)ccc21.O[B]Oc1ccnc(N2CCOCC2)c1.
What is the InChIKey of CID 159495878?
The InChIKey is NBEHBKDAWFEVIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29BrN4O2Si.C13H18BrIN2OSi.C9H12BN2O3/c1-30(2,3)13-12-29-16-27-20-5-4-18(23)15-19(20)22(25-27)17-6-7-24-21(14-17)26-8-10-28-11-9-26;1-19(2,3)7-6-18-9-17-12-5-4-10(14)8-11(12)13(15)16-17;13-10-15-8-1-2-11-9(7-8)12-3-5-14-6-4-12/h4-7,14-15H,8-13,16H2,1-3H3;4-5,8H,6-7,9H2,1-3H3;1-2,7,13H,3-6H2.
What are the key properties of CID 159495878?
CID 159495878 has a molecular weight of 1149.70 g/mol, XLogP of 9.55, 15 rotatable bonds, 1 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159495878 is sourced from PubChem (CID 159495878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).