C26H42N8O2 — CID 159496915
(NE)-N-[(E)-hydrazinylidenehydrazinylidene]nitrous amide;2,3,4,5,6-pentamethyl-N-[2-[2-(2,3,4,5,6-pentamethylanilino)ethoxy]ethyl]aniline (PubChem CID 159496915) has the molecular formula C26H42N8O2 and a molecular weight of 498.68 g/mol. Its IUPAC name is (NE)-N-[(E)-hydrazinylidenehydrazinylidene]nitrous amide;2,3,4,5,6-pentamethyl-N-[2-[2-(2,3,4,5,6-pentamethylanilino)ethoxy]ethyl]aniline.
| Compound Name | (NE)-N-[(E)-hydrazinylidenehydrazinylidene]nitrous amide;2,3,4,5,6-pentamethyl-N-[2-[2-(2,3,4,5,6-pentamethylanilino)ethoxy]ethyl]aniline |
|---|---|
| PubChem CID | 159496915 |
| Molecular Formula | C26H42N8O2 |
| Molecular Weight | 498.68 g/mol |
| Exact Mass | 498.34 |
| IUPAC Name | (NE)-N-[(E)-hydrazinylidenehydrazinylidene]nitrous amide;2,3,4,5,6-pentamethyl-N-[2-[2-(2,3,4,5,6-pentamethylanilino)ethoxy]ethyl]aniline |
| SMILES | Cc1c(C)c(C)c(NCCOCCNc2c(C)c(C)c(C)c(C)c2C)c(C)c1C.N/N=N/N=N/N=O |
| InChI | InChI=1S/C26H40N2O.H2N6O/c1-15-17(3)21(7)25(22(8)18(15)4)27-11-13-29-14-12-28-26-23(9)19(5)16(2)20(6)24(26)10;1-2-3-4-5-6-7/h27-28H,11-14H2,1-10H3;(H2,1,3,5,7) |
| InChIKey | LYWZKJZGAJBFGG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.68 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|